ID: | 1681 | |
---|---|---|
Name: | 4-hydroxy-3-methoxybenzaldehyde | |
Description: | IUPAC names and InChI codes were generated with InstantJChem Original name was: Vanillin | |
Labels: | ||
CAS: | 121-33-5 | |
InChi Code: | InChI=1S/C8H8O3/c1-11-8-4-6(5-9)2-3-7(8)10/h2-5,10H,1H3 |
M1.pLC50: 96-h Fathead minnow toxicity as log(1/LC50) [-log(mol/L)]
Value | Source or prediction |
---|---|
3.26 |
experimental value |
3.6784 |
Tab2.Model_1: P. promelas LC50 (Training set) |
Link | Resource description |
---|---|
DTXSID0021969 | US EPA CompTox Dashboard |