ID: | 1640 | |
---|---|---|
Name: | 4-butylaniline | |
Description: | IUPAC names and InChI codes were generated with InstantJChem Original name was: 4-Butylaniline | |
Labels: | ||
CAS: | 104-13-2 | |
InChi Code: | InChI=1S/C10H15N/c1-2-3-4-9-5-7-10(11)8-6-9/h5-8H,2-4,11H2,1H3 |
M1.pLC50: 96-h Fathead minnow toxicity as log(1/LC50) [-log(mol/L)]
Value | Source or prediction |
---|---|
4.17 |
experimental value |
4.4684 |
Tab2.Model_1: P. promelas LC50 (Training set) |
Link | Resource description |
---|---|
DTXSID8021856 | US EPA CompTox Dashboard |