| ID: | 1625 | |
|---|---|---|
| Name: | 1,2-dichloro-4-methylbenzene | |
| Description: | IUPAC names and InChI codes were generated with InstantJChem Original name was: 3,4-Dichlorotoluene | |
| Labels: | ||
| CAS: | 95-75-0 | |
| InChi Code: | InChI=1S/C7H6Cl2/c1-5-2-3-6(8)7(9)4-5/h2-4H,1H3 |
M1.pLC50: 96-h Fathead minnow toxicity as log(1/LC50) [-log(mol/L)]
| Value | Source or prediction |
|---|---|
| 4.74 |
experimental value |
| 4.4377 |
Tab2.Model_1: P. promelas LC50 (Training set) |
| Link | Resource description |
|---|---|
| DTXSID2021814 | US EPA CompTox Dashboard |