ID: | 1624 | |
---|---|---|
Name: | 1-fluoro-2-methylbenzene | |
Description: | IUPAC names and InChI codes were generated with InstantJChem Original name was: 2-Fluorotoluene | |
Labels: | ||
CAS: | 95-52-3 | |
InChi Code: | InChI=1S/C7H7F/c1-6-4-2-3-5-7(6)8/h2-5H,1H3 |
M1.pLC50: 96-h Fathead minnow toxicity as log(1/LC50) [-log(mol/L)]
Value | Source or prediction |
---|---|
3.75 |
experimental value |
3.807 |
Tab2.Model_1: P. promelas LC50 (Training set) |
Link | Resource description |
---|---|
DTXSID7021811 | US EPA CompTox Dashboard |