| ID: | 1618 | |
|---|---|---|
| Name: | [1,1'-biphenyl]-2-ol | |
| Description: | IUPAC names and InChI codes were generated with InstantJChem Original name was: 2-Phenylphenol | |
| Labels: | ||
| CAS: | 90-43-7 | |
| InChi Code: | InChI=1S/C12H10O/c13-12-9-5-4-8-11(12)10-6-2-1-3-7-10/h1-9,13H |
M1.pLC50: 96-h Fathead minnow toxicity as log(1/LC50) [-log(mol/L)]
| Value | Source or prediction |
|---|---|
| 4.44 |
experimental value |
| 4.6208 |
Tab2.Model_1: P. promelas LC50 (Training set) |
| Link | Resource description |
|---|---|
| DTXSID2021151 | US EPA CompTox Dashboard |