| ID: | 1612 | |
|---|---|---|
| Name: | 1,3-dichloro-2-(dichloromethyl)benzene | |
| Description: | IUPAC names and InChI codes were generated with InstantJChem Original name was: a,a-2,6-Tetrachlorotoluene | |
| Labels: | ||
| CAS: | 81-19-6 | |
| InChi Code: | InChI=1S/C7H4Cl4/c8-4-2-1-3-5(9)6(4)7(10)11/h1-3,7H |
M1.pLC50: 96-h Fathead minnow toxicity as log(1/LC50) [-log(mol/L)]
| Value | Source or prediction |
|---|---|
| 5.38 |
experimental value |
| 5.1375 |
Tab2.Model_1: P. promelas LC50 (Training set) |
| Link | Resource description |
|---|---|
| DTXSID8021773 | US EPA CompTox Dashboard |