| ID: | 1608 | |
|---|---|---|
| Name: | 1-ethynylcyclohexan-1-ol | |
| Description: | IUPAC names and InChI codes were generated with InstantJChem Original name was: 1-Ethynyl-cyclohexanol | |
| Labels: | ||
| CAS: | 78-27-3 | |
| InChi Code: | InChI=1S/C8H12O/c1-2-8(9)6-4-3-5-7-8/h1,9H,3-7H2 |
M1.pLC50: 96-h Fathead minnow toxicity as log(1/LC50) [-log(mol/L)]
| Value | Source or prediction |
|---|---|
| 2.69 |
experimental value |
| 3.1481 |
Tab2.Model_1: P. promelas LC50 (Training set) |
| Link | Resource description |
|---|---|
| DTXSID0021757 | US EPA CompTox Dashboard |