ID: | 1608 | |
---|---|---|
Name: | 1-ethynylcyclohexan-1-ol | |
Description: | IUPAC names and InChI codes were generated with InstantJChem Original name was: 1-Ethynyl-cyclohexanol | |
Labels: | ||
CAS: | 78-27-3 | |
InChi Code: | InChI=1S/C8H12O/c1-2-8(9)6-4-3-5-7-8/h1,9H,3-7H2 |
M1.pLC50: 96-h Fathead minnow toxicity as log(1/LC50) [-log(mol/L)]
Value | Source or prediction |
---|---|
2.69 |
experimental value |
3.1481 |
Tab2.Model_1: P. promelas LC50 (Training set) |
Link | Resource description |
---|---|
DTXSID0021757 | US EPA CompTox Dashboard |