| ID: | 1584 | |
|---|---|---|
| Name: | 2-nitro-9H-carbazole | |
| Description: | IUPAC names and InChI codes were generated with InstantJChem Original name was: 2-Nitrocarbazole The representation of nitro groups was fixed | |
| Labels: | ||
| CAS: | 14191-22-1 | |
| InChi Code: | InChI=1S/C12H8N2O2/c15-14(16)8-5-6-10-9-3-1-2-4-11(9)13-12(10)7-8/h1-7,13H |
M8.logTA100: The mutagenicity potency in TA100 (without the S9 activation system) as log(TA100)
| Value | Source or prediction |
|---|---|
| -0.3 |
experimental value |
| -0.1153 |
Tab2.Model_8: NitroPAH TA100 without S9 (Training set) |
| Link | Resource description |
|---|---|
| DTXSID90161851 | US EPA CompTox Dashboard |