| ID: | 154 | |
|---|---|---|
| Name: | (2S)-octan-2-yl 2-[(4-amino-3,5-dichloro-6-fluoropyridin-2-yl)oxy]acetate | |
| Description: | IUPAC names and InChI codes were generated with InstantJChem Original name was: Fluroxypyr methylheptyl ester | |
| Labels: | ||
| CAS: | 81406-37-3 | |
| InChi Code: | InChI=1S/C15H21Cl2FN2O3/c1-3-4-5-6-7-9(2)23-10(21)8-22-15-12(17)13(19)11(16)14(18)20-15/h9H,3-8H2,1-2H3,(H2,19,20)/t9-/m0/s1 |
M5.logHLn: Biotransformation half-lives in fish
| Value | Source or prediction |
|---|---|
| -0.609174539 |
experimental value |
| -0.6232 |
Tab2.Model_5: Metab. biotransf. fish (Training set) |
M23.pLC50: 96-h Rainbow trout toxicity as log(1/LC50) [-log(mol/L)]
| Value | Source or prediction |
|---|---|
| 6.26 |
experimental value |
| 4.7868 |
Tab2.Model_23: (B)TAZ O. mykiss LC50 (Training set) |