| ID: | 1522 | |
|---|---|---|
| Name: | 1,3,5-trichloro-2-(2,4-dichlorophenoxy)benzene | |
| Description: | IUPAC names and InChI codes were generated with InstantJChem Original name was: 2.2'.4.4'.6-Pentachlorodiphenylether | |
| Labels: | ||
| CAS: | 104294-16-8 | |
| InChi Code: | InChI=1S/C12H5Cl5O/c13-6-1-2-11(8(15)3-6)18-12-9(16)4-7(14)5-10(12)17/h1-5H |
M5.logHLn: Biotransformation half-lives in fish
| Value | Source or prediction |
|---|---|
| 1.690825461 |
experimental value |
| 1.7108 |
Tab2.Model_5: Metab. biotransf. fish (Training set) |
| Link | Resource description |
|---|---|
| DTXSID00146376 | US EPA CompTox Dashboard |