ID: | 1475 | |
---|---|---|
Name: | 3,3',4,4',5-pentachloro-1,1'-biphenyl | |
Description: | IUPAC names and InChI codes were generated with InstantJChem Original name was: 3.3'.4.4'.5-Pentachloro-1.1'-biphenyl | |
Labels: | ||
CAS: | 57465-28-8 | |
InChi Code: | InChI=1S/C12H5Cl5/c13-8-2-1-6(3-9(8)14)7-4-10(15)12(17)11(16)5-7/h1-5H |
M5.logHLn: Biotransformation half-lives in fish
Value | Source or prediction |
---|---|
2.400825461 |
experimental value |
2.1063 |
Tab2.Model_5: Metab. biotransf. fish (Training set) |
Link | Resource description |
---|---|
DTXSID3032179 | US EPA CompTox Dashboard |