| ID: | 1430 | |
|---|---|---|
| Name: | 2,3,3',4',6-pentachloro-1,1'-biphenyl | |
| Description: | IUPAC names and InChI codes were generated with InstantJChem Original name was: 2.3.3'.4'.6-pentachlorobiphenyl (PCB 110) | |
| Labels: | ||
| CAS: | 38380-03-9 | |
| InChi Code: | InChI=1S/C12H5Cl5/c13-7-2-1-6(5-10(7)16)11-8(14)3-4-9(15)12(11)17/h1-5H |
M5.logHLn: Biotransformation half-lives in fish
| Value | Source or prediction |
|---|---|
| 2.634158761 |
experimental value |
| 2.1032 |
Tab2.Model_5: Metab. biotransf. fish (Training set) |
| Link | Resource description |
|---|---|
| DTXSID3038307 | US EPA CompTox Dashboard |