Gramatica, P.; Cassani, S.; Chirico, N. QSARINS-chem: Insubria datasets and new QSAR/QSPR models for environmental pollutants in QSARINS. J. Comput. Chem. 2014, 35, 1036–1044.
Compound
| ID: | 143 | |
|---|---|---|
| Name: | 2-(4-chlorophenyl)-[1,2,4]triazolo[3,2-a]isoquinoline | |
| Description: | IUPAC names and InChI codes were generated with InstantJChem Original name was: Lotrifen | |
| Labels: | ||
| CAS: | 66535-86-2 | |
| InChi Code: | InChI=1S/C16H10ClN3/c17-13-7-5-12(6-8-13)15-18-16-14-4-2-1-3-11(14)9-10-20(16)19-15/h1-10H |
Properties
M18.MP: Melting point [°C]
| Value | Source or prediction |
|---|---|
| 239 |
experimental value |
| 213.951 |
Tab2.Model_18: (B)TAZ melting point (Training set) |