Compound
| ID: | 1318 | |
|---|---|---|
| Name: | 2-methylnon-1-ene | |
| Description: | IUPAC names and InChI codes were generated with InstantJChem Original name was: 2-methyl-1-nonene | |
| Labels: | ||
| CAS: | 2980-71-4 | |
| InChi Code: | InChI=1S/C10H20/c1-4-5-6-7-8-9-10(2)3/h2,4-9H2,1,3H3 |
Properties
M5.logHLn: Biotransformation half-lives in fish
| Value | Source or prediction |
|---|---|
| -0.059174539 |
experimental value |
| 0.1335 |
Tab2.Model_5: Metab. biotransf. fish (Training set) |
Links to External Resources
| Link | Resource description |
|---|---|
| DTXSID40183942 | US EPA CompTox Dashboard |