ID: | 125 | |
---|---|---|
Name: | 5-methoxy-N-{[(2R)-1-(prop-2-en-1-yl)pyrrolidin-2-yl]methyl}-1H-1,2,3-benzotriazole-6-carboximidic acid | |
Description: | IUPAC names and InChI codes were generated with InstantJChem Original name was: Alizapride | |
Labels: | ||
CAS: | 59338-93-1 | |
InChi Code: | InChI=1S/C16H21N5O2/c1-3-6-21-7-4-5-11(21)10-17-16(22)12-8-13-14(19-20-18-13)9-15(12)23-2/h3,8-9,11H,1,4-7,10H2,2H3,(H,17,22)(H,18,19,20)/t11-/m1/s1 |
M17.logKow: The octanol-water partition coefficient as log(Kow)
Value | Source or prediction |
---|---|
1.79 |
experimental value |
2.0628 |
Tab2.Model_17: (B)TAZ logKow (Training set) |
M18.MP: Melting point [°C]
Value | Source or prediction |
---|---|
139 |
experimental value |
142.896 |
Tab2.Model_18: (B)TAZ melting point (Training set) |