| ID: | 1173 | |
|---|---|---|
| Name: | 1-chloro-4-nitrobenzene | |
| Description: | IUPAC names and InChI codes were generated with InstantJChem Original name was: Benzene. 1-chloro-4-nitro- The representation of nitro groups was fixed | |
| Labels: | ||
| CAS: | 100-00-5 | |
| InChi Code: | InChI=1S/C6H4ClNO2/c7-5-1-3-6(4-2-5)8(9)10/h1-4H |
M5.logHLn: Biotransformation half-lives in fish
| Value | Source or prediction |
|---|---|
| -0.484174539 |
experimental value |
| -0.1647 |
Tab2.Model_5: Metab. biotransf. fish (Training set) |
| Link | Resource description |
|---|---|
| DTXSID5020281 | US EPA CompTox Dashboard |