| ID: | 1136 | |
|---|---|---|
| Name: | (1R,6S,13R)-16,17-dimethoxy-6-(prop-1-en-2-yl)-2,7,20-trioxapentacyclo[11.8.0.0³,¹¹.0⁴,⁸.0¹⁴,¹⁹]henicosa-3(11),4(8),9,14,16,18-hexaen-12-one | |
| Description: | IUPAC names and InChI codes were generated with InstantJChem Original name was: Rotenone | |
| Labels: | ||
| CAS: | 83-79-4 | |
| InChi Code: | InChI=1S/C23H22O6/c1-11(2)16-8-14-15(28-16)6-5-12-22(24)21-13-7-18(25-3)19(26-4)9-17(13)27-10-20(21)29-23(12)14/h5-7,9,16,20-21H,1,8,10H2,2-4H3/t16-,20-,21+/m0/s1 |
M1.pLC50: 96-h Fathead minnow toxicity as log(1/LC50) [-log(mol/L)]
| Value | Source or prediction |
|---|---|
| 7.88 |
experimental value |
| 6.973 |
Tab2.Model_1: P. promelas LC50 (Training set) |
M5.logHLn: Biotransformation half-lives in fish
| Value | Source or prediction |
|---|---|
| -0.589174539 |
experimental value |
| 0.4001 |
Tab2.Model_5: Metab. biotransf. fish (Training set) |