ID: | 101 | |
---|---|---|
Name: | 1H-1,2,3-benzotriazole | |
Description: | IUPAC names and InChI codes were generated with InstantJChem Original name was: 2H-Benzotriazole | |
Labels: | ||
CAS: | 273-02-9 | |
InChi Code: | InChI=1S/C6H5N3/c1-2-4-6-5(3-1)7-9-8-6/h1-4H,(H,7,8,9) |
M17.logKow: The octanol-water partition coefficient as log(Kow)
Value | Source or prediction |
---|---|
1.44 |
experimental value |
0.731 |
Tab2.Model_17: (B)TAZ logKow (Training set) |
Link | Resource description |
---|---|
DTXSID6020147 | US EPA CompTox Dashboard |