Compound
| ID: | 643 | |
|---|---|---|
| Name: | Azobenzene | |
| Description: | ||
| Labels: | validation, Other_compounds | |
| CAS: | 103-33-3 | |
| InChi Code: | InChI=1S/C12H10N2/c1-3-7-11(8-4-1)13-14-12-9-5-2-6-10-12/h1-10H |
Properties
logKoc: Logarithm of soil sorption coefficient i
| Value | Source or prediction |
|---|---|
| 3.3 |
experimental value |
| 3.32 |
Eq1: Linear correlation with logP (Validation set) |
| 3.22 |
Eq2: Non-linear regression model (Validation set) |
| 3.22 |
Eq3: Non-linear regression model with correction factors (Validation set) |
Links to External Resources
| Link | Resource description |
|---|---|
| DTXSID8020123 | US EPA CompTox Dashboard |