Wen, Y.; Su, L. M.; Qin, W. C.; Fu, L.; He, J.; Zhao, Y. H. Linear and non-linear relationships between soil sorption and hydrophobicity: Model, validation and influencing factors. Chemosphere 2012, 86, 634–640.
Compound
| ID: | 387 | |
|---|---|---|
| Name: | 2,6-Dichlorobenzamide | |
| Description: | Other name: Chlorthiamid | |
| Labels: | training, Benzamides | |
| CAS: | 2008-58-4 | |
| InChi Code: | InChI=1S/C7H5Cl2NO/c8-4-2-1-3-5(9)6(4)7(10)11/h1-3H,(H2,10,11) |
Properties
logKoc: Logarithm of soil sorption coefficient i
| Value | Source or prediction |
|---|---|
| 0.53 |
experimental value |
| 1.27 |
Eq1: Linear correlation with logP (Training set) |
| 1.49 |
Eq2: Non-linear regression model (Training set) |
| 1.49 |
Eq3: Non-linear regression model with correction factors (Training set) |
Links to External Resources
| Link | Resource description |
|---|---|
| DTXSID7022170 | US EPA CompTox Dashboard |