Wen, Y.; Su, L. M.; Qin, W. C.; Fu, L.; He, J.; Zhao, Y. H. Linear and non-linear relationships between soil sorption and hydrophobicity: Model, validation and influencing factors. Chemosphere 2012, 86, 634–640.
Compound
| ID: | 376 | |
|---|---|---|
| Name: | Fenobucarb | |
| Description: | Other name: 2-sec-Butylphenyl methylcarbamate | |
| Labels: | training, Phenylcarbamates | |
| CAS: | 3766-81-2 | |
| InChi Code: | InChI=1S/C12H17NO2/c1-4-9(2)10-7-5-6-8-11(10)15-12(14)13-3/h5-9H,4H2,1-3H3,(H,13,14) |
Properties
logKoc: Logarithm of soil sorption coefficient i
| Value | Source or prediction |
|---|---|
| 1.71 |
experimental value |
| 2.68 |
Eq1: Linear correlation with logP (Training set) |
| 2.57 |
Eq2: Non-linear regression model (Training set) |
| 2.57 |
Eq3: Non-linear regression model with correction factors (Training set) |
Links to External Resources
| Link | Resource description |
|---|---|
| DTXSID4058077 | US EPA CompTox Dashboard |