Wen, Y.; Su, L. M.; Qin, W. C.; Fu, L.; He, J.; Zhao, Y. H. Linear and non-linear relationships between soil sorption and hydrophobicity: Model, validation and influencing factors. Chemosphere 2012, 86, 634–640.
Compound
| ID: | 374 | |
|---|---|---|
| Name: | Xylicarb | |
| Description: | Other name: 3,4-Xylyl methylcarbamate | |
| Labels: | training, Phenylcarbamates | |
| CAS: | 2425-10-7 | |
| InChi Code: | InChI=1S/C10H13NO2/c1-7-4-5-9(6-8(7)2)13-10(12)11-3/h4-6H,1-3H3,(H,11,12) |
Properties
logKoc: Logarithm of soil sorption coefficient i
| Value | Source or prediction |
|---|---|
| 1.71 |
experimental value |
| 2.13 |
Eq1: Linear correlation with logP (Training set) |
| 2.09 |
Eq2: Non-linear regression model (Training set) |
| 2.09 |
Eq3: Non-linear regression model with correction factors (Training set) |