ID: | 230 | |
---|---|---|
Name: | Bis(2-ethylhexyl) terephthalate | |
Description: | ||
Labels: | training, Benzoates | |
CAS: | 6422-86-2 | |
InChi Code: | InChI=1S/C24H38O4/c1-5-9-11-19(7-3)17-27-23(25)21-13-15-22(16-14-21)24(26)28-18-20(8-4)12-10-6-2/h13-16,19-20H,5-12,17-18H2,1-4H3 |
logKoc: Logarithm of soil sorption coefficient i
Value | Source or prediction |
---|---|
4.16 |
experimental value |
6.21 |
Eq1: Linear correlation with logP (Training set) |
4.89 |
Eq2: Non-linear regression model (Training set) |
4.89 |
Eq3: Non-linear regression model with correction factors (Training set) |
Link | Resource description |
---|---|
DTXSID7027625 | US EPA CompTox Dashboard |