ID: | 229 | |
---|---|---|
Name: | Bis(n-octyl) phthalate | |
Description: | Other name: Dioctyl phthalate | |
Labels: | training, Benzoates | |
CAS: | 117-84-0 | |
InChi Code: | InChI=1S/C24H38O4/c1-3-5-7-9-11-15-19-27-23(25)21-17-13-14-18-22(21)24(26)28-20-16-12-10-8-6-4-2/h13-14,17-18H,3-12,15-16,19-20H2,1-2H3 |
logKoc: Logarithm of soil sorption coefficient i
Value | Source or prediction |
---|---|
4.38 |
experimental value |
6.28 |
Eq1: Linear correlation with logP (Training set) |
4.68 |
Eq2: Non-linear regression model (Training set) |
4.68 |
Eq3: Non-linear regression model with correction factors (Training set) |
Link | Resource description |
---|---|
DTXSID1021956 | US EPA CompTox Dashboard |