Wen, Y.; Su, L. M.; Qin, W. C.; Fu, L.; He, J.; Zhao, Y. H. Linear and non-linear relationships between soil sorption and hydrophobicity: Model, validation and influencing factors. Chemosphere 2012, 86, 634–640.
Compound
| ID: | 176 | |
|---|---|---|
| Name: | 2,6-Dichloro-4-nitroaniline | |
| Description: | Other name: Dichloran | |
| Labels: | training, Anilines | |
| CAS: | 99-30-9 | |
| InChi Code: | InChI=1S/C6H4Cl2N2O2/c7-4-1-3(10(11)12)2-5(8)6(4)9/h1-2H,9H2 |
Properties
logKoc: Logarithm of soil sorption coefficient i
| Value | Source or prediction |
|---|---|
| 3 |
experimental value |
| 2.59 |
Eq1: Linear correlation with logP (Training set) |
| 2.49 |
Eq2: Non-linear regression model (Training set) |
| 2.49 |
Eq3: Non-linear regression model with correction factors (Training set) |
Links to External Resources
| Link | Resource description |
|---|---|
| DTXSID2020426 | US EPA CompTox Dashboard |