Tetteh, J.; Suzuki, T.; Metcalfe, E.; Howells, S. Quantitative Structure-Property Relationships for the Estimation of Boiling Point and Flash Point Using a Radial Basis Function Neural Network. J. Chem. Inf. Model. 1999, 39, 491-507.
Compound
| ID: | 59 | |
|---|---|---|
| Name: | 2-Isopropylbiphenyl | |
| Description: | ||
| Labels: | Validation | |
| CAS: | 19486-60-3 | |
| InChi Code: | InChI=1S/C15H16/c1-12(2)14-10-6-7-11-15(14)13-8-4-3-5-9-13/h3-12H,1-2H3 |
Properties
Tb: Boiling point [°C]
| Value | Source or prediction |
|---|---|
| 270 |
experimental value |
| 296.6 |
Tab7_Tb: RBF-NN model for diverse chemicals (Validation set) |
Tf: Flash point [°C]
| Value | Source or prediction |
|---|---|
| 140.6 |
experimental value |
| 135.1 |
Tab7_Tf: RBF-NN model for diverse chemicals (Validation set) |