Tetteh, J.; Suzuki, T.; Metcalfe, E.; Howells, S. Quantitative Structure-Property Relationships for the Estimation of Boiling Point and Flash Point Using a Radial Basis Function Neural Network. J. Chem. Inf. Model. 1999, 39, 491-507.
Compound
| ID: | 396 | |
|---|---|---|
| Name: | 2-Butoxyethyl salicylate | |
| Description: | ||
| Labels: | Testing | |
| CAS: | 575-83-7 | |
| InChi Code: | InChI=1S/C13H18O4/c1-2-3-8-16-9-10-17-13(15)11-6-4-5-7-12(11)14/h4-7,14H,2-3,8-10H2,1H3 |
Properties
Tb: Boiling point [°C]
| Value | Source or prediction |
|---|---|
| 411 |
experimental value |
| 294.4 |
Tab7_Tb: RBF-NN model for diverse chemicals (Testing set) |
Tf: Flash point [°C]
| Value | Source or prediction |
|---|---|
| 157.2 |
experimental value |
| 148.1 |
Tab7_Tf: RBF-NN model for diverse chemicals (Testing set) |