Tetteh, J.; Suzuki, T.; Metcalfe, E.; Howells, S. Quantitative Structure-Property Relationships for the Estimation of Boiling Point and Flash Point Using a Radial Basis Function Neural Network. J. Chem. Inf. Model. 1999, 39, 491-507.
Compound
| ID: | 381 | |
|---|---|---|
| Name: | Triethylorthoformate | |
| Description: | ||
| Labels: | Testing | |
| CAS: | 122-51-0 | |
| InChi Code: | InChI=1S/C7H16O3/c1-4-8-7(9-5-2)10-6-3/h7H,4-6H2,1-3H3 |
Properties
Tb: Boiling point [°C]
| Value | Source or prediction |
|---|---|
| 143 |
experimental value |
| 158.3 |
Tab7_Tb: RBF-NN model for diverse chemicals (Testing set) |
Tf: Flash point [°C]
| Value | Source or prediction |
|---|---|
| 30 |
experimental value |
| 49.2 |
Tab7_Tf: RBF-NN model for diverse chemicals (Testing set) |