| ID: | 267 | |
|---|---|---|
| Name: | SKB29 | |
| Description: | Systematic name: [3-(4-Dimethylaminomethyl-pyridin-2-yl)-phenyl]-(3-nitro-1H-pyrrol-2-yl)-amine | |
| Labels: | Blood, in_vivo | |
| CAS: | ||
| InChi Code: | InChI=1S/C18H19N5O2/c1-22(2)12-13-6-8-19-16(10-13)14-4-3-5-15(11-14)21-18-17(23(24)25)7-9-20-18/h3-11,20-21H,12H2,1-2H3 |
logBB: Blood-brain distribution
| Value | Source or prediction |
|---|---|
| -0.28 |
experimental value |
| -0.469 |
Eq2: Model for drug-like chemicals, in vivo (Training set) |
| -0.4632 |
Eq5: Model for all chemicals, in vivo and in vitro (Training set) |