Bagheri, M.; Borhani, T. N. G.; Zahedi, G. Estimation of flash point and autoignition temperature of organic sulfur chemicals. Energy Convers. Manage. 2012, 58, 185–196.
Compound
| ID: | 7372-88-5 | |
|---|---|---|
| Name: | 4-methyl dibenzothiophene | |
| Description: | ||
| Labels: | Sulfides/thiophenes | |
| CAS: | 7372-88-5 | |
| InChi Code: | InChI=1S/C13H10S/c1-9-5-4-8-12-13(9)10-6-2-3-7-11(10)14-12/h2-8H,1H3 |
Properties
FP: Flash point [K]
| Value | Source or prediction |
|---|---|
| 447 |
experimental value |
| 433 |
Eq6: PSO-MLR model for flash point (Training set) |
| 451 |
Tab5: FFNN model for flash point (Training set) |
AIT: Auto-Ignition Temperature [K]
| Value | Source or prediction |
|---|---|
| 728 |
experimental value |
| 726 |
Eq7: PSO-MLR model for auto-ignition temperature (Validation set) |
| 728 |
Tab6: FFNN model for auto-ignition temperature (Validation set) |