ID: | 95-49-8 | |
---|---|---|
Name: | 1-Chloro-2-methylbenzene | |
Description: | ||
Labels: | ||
CAS: | 95-49-8 | |
InChi Code: | InChI=1S/C7H7Cl/c1-6-4-2-3-5-7(6)8/h2-5H,1H3 |
Tb: Normal boiling point [K]
Value | Source or prediction |
---|---|
432.15 |
experimental value |
458.36 |
Eq12: Model for normal boiling point (Training set) |
Hvb: Enthalphy of vaporization at normal boiling point [kJ/kg]
Value | Source or prediction |
---|---|
296.23 |
experimental value |
282.89 |
Eq13: Model for enthalphy of vaporization (Training set) |
Link | Resource description |
---|---|
DTXSID8023977 | US EPA CompTox Dashboard |