Abooali, D.; Sobati, M. A. Novel method for prediction of normal boiling point and enthalpy of vaporization at normal boiling point of pure refrigerants: A QSPR approach. Int. J. Refrig. 2014, 40, 282–293.
Compound
| ID: | 25550-14-5 | |
|---|---|---|
| Name: | 1-Ethyl-4-methylbenzene | |
| Description: | ||
| Labels: | ||
| CAS: | 25550-14-5 | |
| InChi Code: | InChI=1S/C9H12/c1-3-9-6-4-8(2)5-7-9/h4-7H,3H2,1-2H3 |
Properties
Tb: Normal boiling point [K]
| Value | Source or prediction |
|---|---|
| 434.25 |
experimental value |
| 429.45 |
Eq12: Model for normal boiling point (Training set) |