Abooali, D.; Sobati, M. A. Novel method for prediction of normal boiling point and enthalpy of vaporization at normal boiling point of pure refrigerants: A QSPR approach. Int. J. Refrig. 2014, 40, 282–293.
Compound
| ID: | 24270-67-5 | |
|---|---|---|
| Name: | 1,1,3-Trifluoropropane | |
| Description: | ||
| Labels: | ||
| CAS: | 24270-67-5 | |
| InChi Code: | InChI=1S/C3H5F3/c4-2-1-3(5)6/h3H,1-2H2 |
Properties
Tb: Normal boiling point [K]
| Value | Source or prediction |
|---|---|
| 265.41 |
experimental value |
| 278.66 |
Eq12: Model for normal boiling point (Training set) |
Hvb: Enthalphy of vaporization at normal boiling point [kJ/kg]
| Value | Source or prediction |
|---|---|
| 230.893 |
experimental value |
| 304.1 |
Eq13: Model for enthalphy of vaporization (Validation set) |
Links to External Resources
| Link | Resource description |
|---|---|
| DTXSID20513167 | US EPA CompTox Dashboard |