Bhhatarai, B.; Gramatica, P. Modelling physico-chemical properties of (benzo)triazoles, and screening for environmental partitioning. Water Res. 2011, 45, 3, 1463–1471.
Compound
| ID: | 014500-23-3 | |
|---|---|---|
| Name: | 4-Methyl-1-phenyl-1,2,4-triazolidine-3,5-dione | |
| Description: | InChI code and name were downloaded from http://cactus.nci.nih.gov | |
| Labels: | ||
| CAS: | 14500-23-3 | |
| InChi Code: | InChI=1S/C9H9N3O2/c1-11-8(13)10-12(9(11)14)7-5-3-2-4-6-7/h2-6H,1H3,(H,10,13) |
Properties
logWS: Aqueous solubility as logWS [mg/L]
| Value | Source or prediction |
|---|---|
| 2.301 |
experimental value |
| 2.68 |
Eq1: Model for aqueous solubility (Training set) |
Links to External Resources
| Link | Resource description |
|---|---|
| DTXSID90162868 | US EPA CompTox Dashboard |