| ID: | 906 | |
|---|---|---|
| Name: | (9R,10S)-dimethyloctadecane | |
| Description: | ||
| Labels: | Paraffins | |
| CAS: | ||
| InChi Code: | InChI=1S/C20H42/c1-5-7-9-11-13-15-17-19(3)20(4)18-16-14-12-10-8-6-2/h19-20H,5-18H2,1-4H3/t19-,20+ |
FP: Flash point [K]
| Value | Source or prediction |
|---|---|
| 361.98 |
FP_PLS-MD: PLS-MD model for flash point (Prediction set) |
| 439.57 |
FP_SVM-GD: SVM-GD model for flash point (Prediction set) |
| 427.87 |
FP_NN-MD: NN-MD model for flash point (Prediction set) |
| 427.31 |
FP_NN-GD: NN-GD model for flash point (Prediction set) |
| 414.17 |
FP_consensus: Consensus model for flash point (Prediction set) |
CN: Cetane number
| Value | Source or prediction |
|---|---|
| 59 |
experimental value |
| 59.23 |
CN_SVM-GD: SVM-GD model for cetane number (Validation set) |
| 48.54 |
CN_SVM-MD: SVM-MD model for cetane number (Validation set) |
| 52.29 |
CN_NN-MD: NN-MD model for cetane number (Validation set) |
| 59.77 |
CN_GRNN-MD: GRNN-MD model for cetane number (Validation set) |