| ID: | 892 | |
|---|---|---|
| Name: | (4R,5S)-diethyloctane | |
| Description: | ||
| Labels: | Paraffins | |
| CAS: | ||
| InChi Code: | InChI=1S/C12H26/c1-5-9-11(7-3)12(8-4)10-6-2/h11-12H,5-10H2,1-4H3/t11-,12+ |
FP: Flash point [K]
| Value | Source or prediction |
|---|---|
| 338.17 |
FP_PLS-MD: PLS-MD model for flash point (Prediction set) |
| 336.14 |
FP_SVM-GD: SVM-GD model for flash point (Prediction set) |
| 344.27 |
FP_NN-MD: NN-MD model for flash point (Prediction set) |
| 339.86 |
FP_NN-GD: NN-GD model for flash point (Prediction set) |
| 339.6 |
FP_consensus: Consensus model for flash point (Prediction set) |
CN: Cetane number
| Value | Source or prediction |
|---|---|
| 20 |
experimental value |
| 41.35 |
CN_SVM-GD: SVM-GD model for cetane number (Validation set) |
| 33.17 |
CN_SVM-MD: SVM-MD model for cetane number (Validation set) |
| 44.04 |
CN_NN-MD: NN-MD model for cetane number (Validation set) |
| 44.32 |
CN_GRNN-MD: GRNN-MD model for cetane number (Validation set) |