| ID: | 598 | |
|---|---|---|
| Name: | sec-butyl hexadecanoate | |
| Description: | ||
| Labels: | Esters | |
| CAS: | ||
| InChi Code: | InChI=1S/C20H40O2/c1-4-6-7-8-9-10-11-12-13-14-15-16-17-18-20(21)22-19(3)5-2/h19H,4-18H2,1-3H3 |
FP: Flash point [K]
| Value | Source or prediction |
|---|---|
| 447.89 |
FP_PLS-MD: PLS-MD model for flash point (Prediction set) |
| 415.85 |
FP_SVM-GD: SVM-GD model for flash point (Prediction set) |
| 431.94 |
FP_NN-MD: NN-MD model for flash point (Prediction set) |
| 406.04 |
FP_NN-GD: NN-GD model for flash point (Prediction set) |
| 425.44 |
FP_consensus: Consensus model for flash point (Prediction set) |
CN: Cetane number
| Value | Source or prediction |
|---|---|
| 84.8 |
experimental value |
| 87.18 |
CN_SVM-GD: SVM-GD model for cetane number (Training set) |
| 84.63 |
CN_SVM-MD: SVM-MD model for cetane number (Training set) |
| 81.22 |
CN_NN-MD: NN-MD model for cetane number (Training set) |
| 85.53 |
CN_GRNN-MD: GRNN-MD model for cetane number (Training set) |