Saldana, D. A.; Starck, L.; Mougin, P.; Rousseau, B.; Pidol, L.; Jeuland, N.; Creton, B. Flash Point and Cetane Number Predictions for Fuel Compounds Using Quantitative Structure Property Relationship (QSPR) Methods. Energy Fuels 2011, 25, 9, 3900–3908.
Compound
| ID: | 427 | |
|---|---|---|
| Name: | ethyl 4-oxopentanoate | |
| Description: | ||
| Labels: | Esters | |
| CAS: | ||
| InChi Code: | InChI=1S/C7H12O3/c1-3-10-7(9)5-4-6(2)8/h3-5H2,1-2H3 |
Properties
FP: Flash point [K]
| Value | Source or prediction |
|---|---|
| 331.63 |
FP_PLS-MD: PLS-MD model for flash point (Prediction set) |
| 359.57 |
FP_SVM-GD: SVM-GD model for flash point (Prediction set) |
| 365.18 |
FP_NN-MD: NN-MD model for flash point (Prediction set) |
| 336.81 |
FP_NN-GD: NN-GD model for flash point (Prediction set) |
| 348.3 |
FP_consensus: Consensus model for flash point (Prediction set) |
CN: Cetane number
| Value | Source or prediction |
|---|---|
| 0 |
experimental value |
| -0.26 |
CN_SVM-GD: SVM-GD model for cetane number (Training set) |
| -0.29 |
CN_SVM-MD: SVM-MD model for cetane number (Training set) |
| -0.51 |
CN_NN-MD: NN-MD model for cetane number (Training set) |
| 7.29 |
CN_GRNN-MD: GRNN-MD model for cetane number (Training set) |
Links to External Resources
| Link | Resource description |
|---|---|
| DTXSID8047058 | US EPA CompTox Dashboard |