| ID: | 225 | |
|---|---|---|
| Name: | 5(R)-phenyleicosane | |
| Description: | ||
| Labels: | Aromatics | |
| CAS: | ||
| InChi Code: | InChI=1S/C26H46/c1-3-5-7-8-9-10-11-12-13-14-15-16-18-22-25(21-6-4-2)26-23-19-17-20-24-26/h17,19-20,23-25H,3-16,18,21-22H2,1-2H3/t25-/m1/s1 |
FP: Flash point [K]
| Value | Source or prediction |
|---|---|
| 523.67 |
FP_PLS-MD: PLS-MD model for flash point (Prediction set) |
| 469.74 |
FP_SVM-GD: SVM-GD model for flash point (Prediction set) |
| 438.67 |
FP_NN-MD: NN-MD model for flash point (Prediction set) |
| 483.45 |
FP_NN-GD: NN-GD model for flash point (Prediction set) |
| 478.88 |
FP_consensus: Consensus model for flash point (Prediction set) |
CN: Cetane number
| Value | Source or prediction |
|---|---|
| 39 |
experimental value |
| 39.27 |
CN_SVM-GD: SVM-GD model for cetane number (Training set) |
| 45.08 |
CN_SVM-MD: SVM-MD model for cetane number (Training set) |
| 45.41 |
CN_NN-MD: NN-MD model for cetane number (Training set) |
| 39.66 |
CN_GRNN-MD: GRNN-MD model for cetane number (Training set) |