Saldana, D. A.; Starck, L.; Mougin, P.; Rousseau, B.; Pidol, L.; Jeuland, N.; Creton, B. Flash Point and Cetane Number Predictions for Fuel Compounds Using Quantitative Structure Property Relationship (QSPR) Methods. Energy Fuels 2011, 25, 9, 3900–3908.
Compound
| ID: | 186 | |
|---|---|---|
| Name: | 1,3-xylene | |
| Description: | ||
| Labels: | Aromatics | |
| CAS: | ||
| InChi Code: | InChI=1S/C8H10/c1-7-4-3-5-8(2)6-7/h3-6H,1-2H3 |
Properties
FP: Flash point [K]
| Value | Source or prediction |
|---|---|
| 298.15 |
experimental value |
| 296.94 |
FP_PLS-MD: PLS-MD model for flash point (Validation set) |
| 303.31 |
FP_SVM-GD: SVM-GD model for flash point (Validation set) |
| 294.29 |
FP_NN-MD: NN-MD model for flash point (Validation set) |
| 302.98 |
FP_NN-GD: NN-GD model for flash point (Validation set) |
| 299.38 |
FP_consensus: Consensus model for flash point (Validation set) |
CN: Cetane number
| Value | Source or prediction |
|---|---|
| 1 |
experimental value |
| 0.73 |
CN_SVM-GD: SVM-GD model for cetane number (Training set) |
| -1.85 |
CN_SVM-MD: SVM-MD model for cetane number (Training set) |
| 1.54 |
CN_NN-MD: NN-MD model for cetane number (Training set) |
| -0.18 |
CN_GRNN-MD: GRNN-MD model for cetane number (Training set) |
Links to External Resources
| Link | Resource description |
|---|---|
| DTXSID6026298 | US EPA CompTox Dashboard |