| ID: | N821 | |
|---|---|---|
| Name: | triethylamine, 1-ethyl-3-methylimidazolium dicyanamide | |
| Description: | triethylamine [EMIm]+[N(CN)2]- | |
| Labels: | ||
| CAS: | ||
| InChi Code: | InChI=1S/C6H11N2.C6H15N.C2N3/c1-3-8-5-4-7(2)6-8;1-4-7(5-2)6-3;3-1-5-2-4/h4-6H,3H2,1-2H3;4-6H2,1-3H3;/q+1;;-1 |
logK: Gas-ionic liquid partition coefficient
| Value | Source or prediction |
|---|---|
| 1.56 |
experimental value |
| 2.412125817308842 |
MLR: Multiple Linear Regression QSAR model for the gas-ionic liquid partition coefficient of organic solutes (MLR holdout predictions) |
| 2.070152945427765 |
RF: Random Forest Regression QSAR model for gas-ionic liquid partition coefficient of organic solutes (RF holdout predictions) |