| ID: | N6521 | |
|---|---|---|
| Name: | p-cresol, n-butyl-n-methylpiperidinium bis(trifluoromethylsulfonyl)imide | |
| Description: | p-cresol [BMPip]+[(Tf)2N]- | |
| Labels: | ||
| CAS: | ||
| InChi Code: | InChI=1S/C10H22N.C7H8O.C2F6NO4S2/c1-3-4-8-11(2)9-6-5-7-10-11;1-6-2-4-7(8)5-3-6;3-1(4,5)14(10,11)9-15(12,13)2(6,7)8/h3-10H2,1-2H3;2-5,8H,1H3;/q+1;;-1 |
logK: Gas-ionic liquid partition coefficient
| Value | Source or prediction |
|---|---|
| 6.218211828542935 |
experimental value |
| 5.588487240837836 |
MLR: Multiple Linear Regression QSAR model for the gas-ionic liquid partition coefficient of organic solutes (MLR holdout predictions) |
| 5.541064208559221 |
RF: Random Forest Regression QSAR model for gas-ionic liquid partition coefficient of organic solutes (RF holdout predictions) |