| ID: | N6421 | |
|---|---|---|
| Name: | benzonitrile, 1-butyl-3-methylimidazolium octylsulfate | |
| Description: | benzonitrile [MBIm]+[OtSO4]- | |
| Labels: | ||
| CAS: | ||
| InChi Code: | InChI=1S/C8H15N2.C8H18O4S.C7H5N/c1-3-4-5-10-7-6-9(2)8-10;1-2-3-4-5-6-7-8-12-13(9,10)11;8-6-7-4-2-1-3-5-7/h6-8H,3-5H2,1-2H3;2-8H2,1H3,(H,9,10,11);1-5H/q+1;;/p-1 |
logK: Gas-ionic liquid partition coefficient
| Value | Source or prediction |
|---|---|
| 5.269 |
experimental value |
| 5.864994721487754 |
MLR: Multiple Linear Regression QSAR model for the gas-ionic liquid partition coefficient of organic solutes (MLR holdout predictions) |
| 5.058476135089585 |
RF: Random Forest Regression QSAR model for gas-ionic liquid partition coefficient of organic solutes (RF holdout predictions) |