| ID: | N6351 | |
|---|---|---|
| Name: | benzaldehyde, n-butyl-n-methylpyrrolidinium tetracyanoborate | |
| Description: | benzaldehyde [BMPyrr]+[B(CN)4]- | |
| Labels: | ||
| CAS: | ||
| InChi Code: | InChI=1S/C9H20N.C7H6O.C4BN4/c1-3-4-7-10(2)8-5-6-9-10;8-6-7-4-2-1-3-5-7;6-1-5(2-7,3-8)4-9/h3-9H2,1-2H3;1-6H;/q+1;;-1 |
logK: Gas-ionic liquid partition coefficient
| Value | Source or prediction |
|---|---|
| 4.928326220792233 |
experimental value |
| 5.225536853652127 |
MLR: Multiple Linear Regression QSAR model for the gas-ionic liquid partition coefficient of organic solutes (MLR holdout predictions) |
| 4.711233693216857 |
RF: Random Forest Regression QSAR model for gas-ionic liquid partition coefficient of organic solutes (RF holdout predictions) |