| ID: | N6226 | |
|---|---|---|
| Name: | 1-hexanol, 1-ethyl-3-methylimidazolium ethylsulfate | |
| Description: | 1-hexanol [MEIm]+[EtSO4]- | |
| Labels: | ||
| CAS: | ||
| InChi Code: | InChI=1S/C6H11N2.C6H14O.C2H6O4S/c1-3-8-5-4-7(2)6-8;1-2-3-4-5-6-7;1-2-6-7(3,4)5/h4-6H,3H2,1-2H3;7H,2-6H2,1H3;2H2,1H3,(H,3,4,5)/q+1;;/p-1 |
logK: Gas-ionic liquid partition coefficient
| Value | Source or prediction |
|---|---|
| 4.368 |
experimental value |
| 3.866779140185358 |
MLR: Multiple Linear Regression QSAR model for the gas-ionic liquid partition coefficient of organic solutes (MLR holdout predictions) |
| 4.03965664160467 |
RF: Random Forest Regression QSAR model for gas-ionic liquid partition coefficient of organic solutes (RF holdout predictions) |