| ID: | N6056 | |
|---|---|---|
| Name: | styrene, n-butyl-n-methylpyrrolidinium bis(fluorosulfonyl)imide | |
| Description: | styrene [BMPyrr]+[FSI]- | |
| Labels: | ||
| CAS: | ||
| InChi Code: | InChI=1S/C9H20N.C8H8.F2NO4S2/c1-3-4-7-10(2)8-5-6-9-10;1-2-8-6-4-3-5-7-8;1-8(4,5)3-9(2,6)7/h3-9H2,1-2H3;2-7H,1H2;/q+1;;-1 |
logK: Gas-ionic liquid partition coefficient
| Value | Source or prediction |
|---|---|
| 4.036710813504455 |
experimental value |
| 3.459748582200454 |
MLR: Multiple Linear Regression QSAR model for the gas-ionic liquid partition coefficient of organic solutes (MLR holdout predictions) |
| 3.965298393694279 |
RF: Random Forest Regression QSAR model for gas-ionic liquid partition coefficient of organic solutes (RF holdout predictions) |