| ID: | N5741 | |
|---|---|---|
| Name: | 1-pentanol, 4-cyano-1-butylpyridinium bis(trifluoromethylsulfonyl)imide | |
| Description: | 1-pentanol [4-CNBPy]+[(Tf)2N]- | |
| Labels: | ||
| CAS: | ||
| InChi Code: | InChI=1S/C10H13N2.C5H12O.C2F6NO4S2/c1-2-3-6-12-7-4-10(9-11)5-8-12;1-2-3-4-5-6;3-1(4,5)14(10,11)9-15(12,13)2(6,7)8/h4-5,7-8H,2-3,6H2,1H3;6H,2-5H2,1H3;/q+1;;-1 |
logK: Gas-ionic liquid partition coefficient
| Value | Source or prediction |
|---|---|
| 3.774 |
experimental value |
| 3.58713446154055 |
MLR: Multiple Linear Regression QSAR model for the gas-ionic liquid partition coefficient of organic solutes (MLR holdout predictions) |
| 3.831395901077079 |
RF: Random Forest Regression QSAR model for gas-ionic liquid partition coefficient of organic solutes (RF holdout predictions) |