| ID: | N5591 | |
|---|---|---|
| Name: | pyridine, n-butyl-n-methylpyrrolidinium bis(trifluoromethylsulfonyl)imide | |
| Description: | pyridine [C4MPyrr]+[Tf2N]- | |
| Labels: | ||
| CAS: | ||
| InChi Code: | InChI=1S/C9H20N.C5H5N.C2F6NO4S2/c1-3-4-7-10(2)8-5-6-9-10;1-2-4-6-5-3-1;3-1(4,5)14(10,11)9-15(12,13)2(6,7)8/h3-9H2,1-2H3;1-5H;/q+1;;-1 |
logK: Gas-ionic liquid partition coefficient
| Value | Source or prediction |
|---|---|
| 3.693464128794231 |
experimental value |
| 3.887679569111653 |
MLR: Multiple Linear Regression QSAR model for the gas-ionic liquid partition coefficient of organic solutes (MLR holdout predictions) |
| 3.697778356889518 |
RF: Random Forest Regression QSAR model for gas-ionic liquid partition coefficient of organic solutes (RF holdout predictions) |