| ID: | N556 | |
|---|---|---|
| Name: | 1-heptene, n-butyl-n-methylpiperidinium thiocyanate | |
| Description: | 1-heptene [BMPip]+[SCN]- | |
| Labels: | ||
| CAS: | ||
| InChi Code: | InChI=1S/C10H22N.C7H14.CHNS/c1-3-4-8-11(2)9-6-5-7-10-11;1-3-5-7-6-4-2;2-1-3/h3-10H2,1-2H3;3H,1,4-7H2,2H3;3H/q+1;;/p-1 |
logK: Gas-ionic liquid partition coefficient
| Value | Source or prediction |
|---|---|
| 1.339 |
experimental value |
| 1.740429145509757 |
MLR: Multiple Linear Regression QSAR model for the gas-ionic liquid partition coefficient of organic solutes (MLR holdout predictions) |
| 1.398016937942829 |
RF: Random Forest Regression QSAR model for gas-ionic liquid partition coefficient of organic solutes (RF holdout predictions) |