| ID: | N5466 | |
|---|---|---|
| Name: | nitroethane, 1-butyl-2,3-dimethylimidazolium bis(trifluoromethylsulfonyl)imide | |
| Description: | nitroethane [BM2Im]+[(Tf)2N]- | |
| Labels: | ||
| CAS: | ||
| InChi Code: | InChI=1S/C9H17N2.C2F6NO4S2.C2H5NO2/c1-4-5-6-11-8-7-10(3)9(11)2;3-1(4,5)14(10,11)9-15(12,13)2(6,7)8;1-2-3(4)5/h7-8H,4-6H2,1-3H3;;2H2,1H3/q+1;-1; |
logK: Gas-ionic liquid partition coefficient
| Value | Source or prediction |
|---|---|
| 3.632 |
experimental value |
| 3.802029347632972 |
MLR: Multiple Linear Regression QSAR model for the gas-ionic liquid partition coefficient of organic solutes (MLR holdout predictions) |
| 3.635110420444392 |
RF: Random Forest Regression QSAR model for gas-ionic liquid partition coefficient of organic solutes (RF holdout predictions) |